C20H33NO2 — CID 10381299
(1R,2S)-1-cyclohexyl-2-(diethylamino)-3-phenylmethoxypropan-1-ol (PubChem CID 10381299) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is (1R,2S)-1-cyclohexyl-2-(diethylamino)-3-phenylmethoxypropan-1-ol.
| Compound Name | (1R,2S)-1-cyclohexyl-2-(diethylamino)-3-phenylmethoxypropan-1-ol |
|---|---|
| PubChem CID | 10381299 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | (1R,2S)-1-cyclohexyl-2-(diethylamino)-3-phenylmethoxypropan-1-ol |
| SMILES | CCN(CC)[C@@H](COCc1ccccc1)[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C20H33NO2/c1-3-21(4-2)19(20(22)18-13-9-6-10-14-18)16-23-15-17-11-7-5-8-12-17/h5,7-8,11-12,18-20,22H,3-4,6,9-10,13-16H2,1-2H3/t19-,20+/m0/s1 |
| InChIKey | VVRQCLLMLIBHSY-VQTJNVASSA-N |
| XLogP | 3.85 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |