C22H35NO2 — CID 798688
(2R)-1-(dicyclohexylamino)-3-phenylmethoxypropan-2-ol (PubChem CID 798688) has the molecular formula C22H35NO2 and a molecular weight of 345.53 g/mol. Its IUPAC name is (2R)-1-(dicyclohexylamino)-3-phenylmethoxypropan-2-ol.
| Compound Name | (2R)-1-(dicyclohexylamino)-3-phenylmethoxypropan-2-ol |
|---|---|
| PubChem CID | 798688 |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | (2R)-1-(dicyclohexylamino)-3-phenylmethoxypropan-2-ol |
| SMILES | O[C@@H](COCc1ccccc1)CN(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C22H35NO2/c24-22(18-25-17-19-10-4-1-5-11-19)16-23(20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1,4-5,10-11,20-22,24H,2-3,6-9,12-18H2/t22-/m1/s1 |
| InChIKey | DTEMPXLYQBOHLH-JOCHJYFZSA-N |
| XLogP | 4.53 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |