C18H28ClNO2 — CID 2392576
(2S)-1-[(4-chlorophenyl)methoxy]-3-[cyclohexyl(ethyl)amino]propan-2-ol (PubChem CID 2392576) has the molecular formula C18H28ClNO2 and a molecular weight of 325.88 g/mol. Its IUPAC name is (2S)-1-[(4-chlorophenyl)methoxy]-3-[cyclohexyl(ethyl)amino]propan-2-ol.
| Compound Name | (2S)-1-[(4-chlorophenyl)methoxy]-3-[cyclohexyl(ethyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 2392576 |
| Molecular Formula | C18H28ClNO2 |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (2S)-1-[(4-chlorophenyl)methoxy]-3-[cyclohexyl(ethyl)amino]propan-2-ol |
| SMILES | CCN(C[C@H](O)COCc1ccc(Cl)cc1)C1CCCCC1 |
| InChI | InChI=1S/C18H28ClNO2/c1-2-20(17-6-4-3-5-7-17)12-18(21)14-22-13-15-8-10-16(19)11-9-15/h8-11,17-18,21H,2-7,12-14H2,1H3/t18-/m0/s1 |
| InChIKey | UDGVNVUFJGOZDT-SFHVURJKSA-N |
| XLogP | 3.87 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |