C19H31ClNO2- — CID 21237610
1-[cyclohexyl(ethyl)amino]-3-(2,4-dimethylphenoxy)propan-2-ol chloride (PubChem CID 21237610) has the molecular formula C19H31ClNO2- and a molecular weight of 340.92 g/mol. Its IUPAC name is 1-[cyclohexyl(ethyl)amino]-3-(2,4-dimethylphenoxy)propan-2-ol chloride.
| Compound Name | 1-[cyclohexyl(ethyl)amino]-3-(2,4-dimethylphenoxy)propan-2-ol chloride |
|---|---|
| PubChem CID | 21237610 |
| Molecular Formula | C19H31ClNO2- |
| Molecular Weight | 340.92 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 1-[cyclohexyl(ethyl)amino]-3-(2,4-dimethylphenoxy)propan-2-ol chloride |
| SMILES | CCN(CC(O)COc1ccc(C)cc1C)C1CCCCC1.[Cl-] |
| InChI | InChI=1S/C19H31NO2.ClH/c1-4-20(17-8-6-5-7-9-17)13-18(21)14-22-19-11-10-15(2)12-16(19)3;/h10-12,17-18,21H,4-9,13-14H2,1-3H3;1H/p-1 |
| InChIKey | RDTNGDASHYGKSM-UHFFFAOYSA-M |
| XLogP | 0.70 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.92 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |