C23H31NO3 — CID 7872383
2-[[cyclohexyl-[(2S)-2-hydroxy-3-(2-methylphenoxy)propyl]amino]methyl]phenol (PubChem CID 7872383) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is 2-[[cyclohexyl-[(2S)-2-hydroxy-3-(2-methylphenoxy)propyl]amino]methyl]phenol.
| Compound Name | 2-[[cyclohexyl-[(2S)-2-hydroxy-3-(2-methylphenoxy)propyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 7872383 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 2-[[cyclohexyl-[(2S)-2-hydroxy-3-(2-methylphenoxy)propyl]amino]methyl]phenol |
| SMILES | Cc1ccccc1OC[C@@H](O)CN(Cc1ccccc1O)C1CCCCC1 |
| InChI | InChI=1S/C23H31NO3/c1-18-9-5-8-14-23(18)27-17-21(25)16-24(20-11-3-2-4-12-20)15-19-10-6-7-13-22(19)26/h5-10,13-14,20-21,25-26H,2-4,11-12,15-17H2,1H3/t21-/m0/s1 |
| InChIKey | KQTVIFQARXOSBP-NRFANRHFSA-N |
| XLogP | 4.28 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|