C17H27ClNO2- — CID 21236643
1-(2,6-dimethylpiperidin-1-yl)-3-phenylmethoxypropan-2-ol chloride (PubChem CID 21236643) has the molecular formula C17H27ClNO2- and a molecular weight of 312.86 g/mol. Its IUPAC name is 1-(2,6-dimethylpiperidin-1-yl)-3-phenylmethoxypropan-2-ol chloride.
| Compound Name | 1-(2,6-dimethylpiperidin-1-yl)-3-phenylmethoxypropan-2-ol chloride |
|---|---|
| PubChem CID | 21236643 |
| Molecular Formula | C17H27ClNO2- |
| Molecular Weight | 312.86 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-(2,6-dimethylpiperidin-1-yl)-3-phenylmethoxypropan-2-ol chloride |
| SMILES | CC1CCCC(C)N1CC(O)COCc1ccccc1.[Cl-] |
| InChI | InChI=1S/C17H27NO2.ClH/c1-14-7-6-8-15(2)18(14)11-17(19)13-20-12-16-9-4-3-5-10-16;/h3-5,9-10,14-15,17,19H,6-8,11-13H2,1-2H3;1H/p-1 |
| InChIKey | KMVDZKPWUDIGIX-UHFFFAOYSA-M |
| XLogP | -0.17 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.86 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |