C38H46N2OS — CID 11548747
(2S,3S)-1-N,3-N,3-N-tribenzyl-2-cyclohexylsulfanyl-4-phenylmethoxybutane-1,3-diamine (PubChem CID 11548747) has the molecular formula C38H46N2OS and a molecular weight of 578.87 g/mol. Its IUPAC name is (2S,3S)-1-N,3-N,3-N-tribenzyl-2-cyclohexylsulfanyl-4-phenylmethoxybutane-1,3-diamine.
| Compound Name | (2S,3S)-1-N,3-N,3-N-tribenzyl-2-cyclohexylsulfanyl-4-phenylmethoxybutane-1,3-diamine |
|---|---|
| PubChem CID | 11548747 |
| Molecular Formula | C38H46N2OS |
| Molecular Weight | 578.87 g/mol |
| Exact Mass | 578.33 |
| IUPAC Name | (2S,3S)-1-N,3-N,3-N-tribenzyl-2-cyclohexylsulfanyl-4-phenylmethoxybutane-1,3-diamine |
| SMILES | c1ccc(CNC[C@H](SC2CCCCC2)[C@H](COCc2ccccc2)N(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C38H46N2OS/c1-6-16-32(17-7-1)26-39-27-38(42-36-24-14-5-15-25-36)37(31-41-30-35-22-12-4-13-23-35)40(28-33-18-8-2-9-19-33)29-34-20-10-3-11-21-34/h1-4,6-13,16-23,36-39H,5,14-15,24-31H2/t37-,38-/m0/s1 |
| InChIKey | VCZSQXBFYCEBDS-UWXQCODUSA-N |
| XLogP | 8.50 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.87 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |