C19H28O — CID 106651347
[(1E)-cycloocten-1-yl]-[4-(2-methylpropyl)phenyl]methanol (PubChem CID 106651347) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is [(1E)-cycloocten-1-yl]-[4-(2-methylpropyl)phenyl]methanol.
| Compound Name | [(1E)-cycloocten-1-yl]-[4-(2-methylpropyl)phenyl]methanol |
|---|---|
| PubChem CID | 106651347 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | [(1E)-cycloocten-1-yl]-[4-(2-methylpropyl)phenyl]methanol |
| SMILES | CC(C)Cc1ccc(C(O)/C2=C/CCCCCC2)cc1 |
| InChI | InChI=1S/C19H28O/c1-15(2)14-16-10-12-18(13-11-16)19(20)17-8-6-4-3-5-7-9-17/h8,10-13,15,19-20H,3-7,9,14H2,1-2H3/b17-8+ |
| InChIKey | ROCBBZAVZPGQCT-CAOOACKPSA-N |
| XLogP | 5.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|