C22H32O2Si — CID 101185114
tert-butyl-[3-(cyclohexen-1-yl)-3-phenylmethoxyprop-1-ynoxy]-dimethylsilane (PubChem CID 101185114) has the molecular formula C22H32O2Si and a molecular weight of 356.58 g/mol. Its IUPAC name is tert-butyl-[3-(cyclohexen-1-yl)-3-phenylmethoxyprop-1-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[3-(cyclohexen-1-yl)-3-phenylmethoxyprop-1-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101185114 |
| Molecular Formula | C22H32O2Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | tert-butyl-[3-(cyclohexen-1-yl)-3-phenylmethoxyprop-1-ynoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC#CC(OCc1ccccc1)C1=CCCCC1 |
| InChI | InChI=1S/C22H32O2Si/c1-22(2,3)25(4,5)24-17-16-21(20-14-10-7-11-15-20)23-18-19-12-8-6-9-13-19/h6,8-9,12-14,21H,7,10-11,15,18H2,1-5H3 |
| InChIKey | JEOLZPSLPHNLMZ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|