C37H58O5Si2 — CID 71479466
(2S,3S,7S,10R)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7-bis(phenylmethoxy)undec-5-yn-4-one (PubChem CID 71479466) has the molecular formula C37H58O5Si2 and a molecular weight of 639.04 g/mol. Its IUPAC name is (2S,3S,7S,10R)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7-bis(phenylmethoxy)undec-5-yn-4-one.
| Compound Name | (2S,3S,7S,10R)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7-bis(phenylmethoxy)undec-5-yn-4-one |
|---|---|
| PubChem CID | 71479466 |
| Molecular Formula | C37H58O5Si2 |
| Molecular Weight | 639.04 g/mol |
| Exact Mass | 638.38 |
| IUPAC Name | (2S,3S,7S,10R)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7-bis(phenylmethoxy)undec-5-yn-4-one |
| SMILES | C[C@H](CC[C@@H](C#CC(=O)[C@@H](OCc1ccccc1)[C@H](C)O[Si](C)(C)C(C)(C)C)OCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H58O5Si2/c1-29(41-43(9,10)36(3,4)5)23-24-33(39-27-31-19-15-13-16-20-31)25-26-34(38)35(40-28-32-21-17-14-18-22-32)30(2)42-44(11,12)37(6,7)8/h13-22,29-30,33,35H,23-24,27-28H2,1-12H3/t29-,30+,33+,35+/m1/s1 |
| InChIKey | WLBWYVSPDAKWPN-ZGFYEYRMSA-N |
| XLogP | 9.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.04 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|