C19H32O3Si — CID 139917803
(4R)-4-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxyhexanal (PubChem CID 139917803) has the molecular formula C19H32O3Si and a molecular weight of 336.55 g/mol. Its IUPAC name is (4R)-4-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxyhexanal.
| Compound Name | (4R)-4-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxyhexanal |
|---|---|
| PubChem CID | 139917803 |
| Molecular Formula | C19H32O3Si |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | (4R)-4-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxyhexanal |
| SMILES | CC(OCc1ccccc1)[C@@H](CCC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H32O3Si/c1-16(21-15-17-11-8-7-9-12-17)18(13-10-14-20)22-23(5,6)19(2,3)4/h7-9,11-12,14,16,18H,10,13,15H2,1-6H3/t16?,18-/m1/s1 |
| InChIKey | IYBVNEPBRQORBG-UHUGOGIASA-N |
| XLogP | 4.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|