C33H45NO3Si — CID 11180121
(4R,5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-(dibenzylamino)-4-phenylmethoxyhexanal (PubChem CID 11180121) has the molecular formula C33H45NO3Si and a molecular weight of 531.81 g/mol. Its IUPAC name is (4R,5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-(dibenzylamino)-4-phenylmethoxyhexanal.
| Compound Name | (4R,5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-(dibenzylamino)-4-phenylmethoxyhexanal |
|---|---|
| PubChem CID | 11180121 |
| Molecular Formula | C33H45NO3Si |
| Molecular Weight | 531.81 g/mol |
| Exact Mass | 531.32 |
| IUPAC Name | (4R,5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-(dibenzylamino)-4-phenylmethoxyhexanal |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]([C@@H](CCC=O)OCc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C33H45NO3Si/c1-33(2,3)38(4,5)37-27-31(32(22-15-23-35)36-26-30-20-13-8-14-21-30)34(24-28-16-9-6-10-17-28)25-29-18-11-7-12-19-29/h6-14,16-21,23,31-32H,15,22,24-27H2,1-5H3/t31-,32+/m0/s1 |
| InChIKey | SOYYRSQMROWPSN-AJQTZOPKSA-N |
| XLogP | 7.64 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.81 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|