C26H37NO3Si — CID 11212824
prop-2-enyl (2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)propanoate (PubChem CID 11212824) has the molecular formula C26H37NO3Si and a molecular weight of 439.67 g/mol. Its IUPAC name is prop-2-enyl (2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)propanoate.
| Compound Name | prop-2-enyl (2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)propanoate |
|---|---|
| PubChem CID | 11212824 |
| Molecular Formula | C26H37NO3Si |
| Molecular Weight | 439.67 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | prop-2-enyl (2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)propanoate |
| SMILES | C=CCOC(=O)[C@H](CO[Si](C)(C)C(C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H37NO3Si/c1-7-18-29-25(28)24(21-30-31(5,6)26(2,3)4)27(19-22-14-10-8-11-15-22)20-23-16-12-9-13-17-23/h7-17,24H,1,18-21H2,2-6H3/t24-/m0/s1 |
| InChIKey | GTKFEVPCMGTXNA-DEOSSOPVSA-N |
| XLogP | 5.81 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.67 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|