C28H41NO3Si — CID 44632350
(E,6S,7R)-8-[tert-butyl(dimethyl)silyl]oxy-7-(dibenzylamino)-6-hydroxyoct-2-en-4-one (PubChem CID 44632350) has the molecular formula C28H41NO3Si and a molecular weight of 467.73 g/mol. Its IUPAC name is (E,6S,7R)-8-[tert-butyl(dimethyl)silyl]oxy-7-(dibenzylamino)-6-hydroxyoct-2-en-4-one.
| Compound Name | (E,6S,7R)-8-[tert-butyl(dimethyl)silyl]oxy-7-(dibenzylamino)-6-hydroxyoct-2-en-4-one |
|---|---|
| PubChem CID | 44632350 |
| Molecular Formula | C28H41NO3Si |
| Molecular Weight | 467.73 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | (E,6S,7R)-8-[tert-butyl(dimethyl)silyl]oxy-7-(dibenzylamino)-6-hydroxyoct-2-en-4-one |
| SMILES | C/C=C/C(=O)C[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H41NO3Si/c1-7-14-25(30)19-27(31)26(22-32-33(5,6)28(2,3)4)29(20-23-15-10-8-11-16-23)21-24-17-12-9-13-18-24/h7-18,26-27,31H,19-22H2,1-6H3/b14-7+/t26-,27+/m1/s1 |
| InChIKey | UBRCPBQQRREGEE-LDENZZFPSA-N |
| XLogP | 5.98 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.73 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|