C23H40O3Si — CID 53387980
(Z,2S,3S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2-phenylmethoxydec-5-en-3-ol (PubChem CID 53387980) has the molecular formula C23H40O3Si and a molecular weight of 392.66 g/mol. Its IUPAC name is (Z,2S,3S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2-phenylmethoxydec-5-en-3-ol.
| Compound Name | (Z,2S,3S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2-phenylmethoxydec-5-en-3-ol |
|---|---|
| PubChem CID | 53387980 |
| Molecular Formula | C23H40O3Si |
| Molecular Weight | 392.66 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | (Z,2S,3S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-2-phenylmethoxydec-5-en-3-ol |
| SMILES | C[C@H](CC/C=C\C[C@H](O)[C@H](C)OCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H40O3Si/c1-19(26-27(6,7)23(3,4)5)14-10-8-13-17-22(24)20(2)25-18-21-15-11-9-12-16-21/h8-9,11-13,15-16,19-20,22,24H,10,14,17-18H2,1-7H3/b13-8-/t19-,20+,22+/m1/s1 |
| InChIKey | SOYKZJHUCGAUNZ-HOAIDWIBSA-N |
| XLogP | 6.09 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.66 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|