C21H36O3Si — CID 101339691
(E,2S,3S)-7-[tert-butyl(dimethyl)silyl]oxy-5-methyl-2-phenylmethoxyhept-4-en-3-ol (PubChem CID 101339691) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is (E,2S,3S)-7-[tert-butyl(dimethyl)silyl]oxy-5-methyl-2-phenylmethoxyhept-4-en-3-ol.
| Compound Name | (E,2S,3S)-7-[tert-butyl(dimethyl)silyl]oxy-5-methyl-2-phenylmethoxyhept-4-en-3-ol |
|---|---|
| PubChem CID | 101339691 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | (E,2S,3S)-7-[tert-butyl(dimethyl)silyl]oxy-5-methyl-2-phenylmethoxyhept-4-en-3-ol |
| SMILES | C/C(=C\[C@H](O)[C@H](C)OCc1ccccc1)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36O3Si/c1-17(13-14-24-25(6,7)21(3,4)5)15-20(22)18(2)23-16-19-11-9-8-10-12-19/h8-12,15,18,20,22H,13-14,16H2,1-7H3/b17-15+/t18-,20-/m0/s1 |
| InChIKey | FCJVEPIYWUAZKN-ZAJNYPRISA-N |
| XLogP | 5.31 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|