C18H34O3Si — CID 46180290
(2Z,4S,5S,6E)-9-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4,7-trimethylnona-2,6-dienal (PubChem CID 46180290) has the molecular formula C18H34O3Si and a molecular weight of 326.55 g/mol. Its IUPAC name is (2Z,4S,5S,6E)-9-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4,7-trimethylnona-2,6-dienal.
| Compound Name | (2Z,4S,5S,6E)-9-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4,7-trimethylnona-2,6-dienal |
|---|---|
| PubChem CID | 46180290 |
| Molecular Formula | C18H34O3Si |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | (2Z,4S,5S,6E)-9-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4,7-trimethylnona-2,6-dienal |
| SMILES | C/C(C=O)=C/[C@H](C)[C@H](O)/C=C(\C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34O3Si/c1-14(9-10-21-22(7,8)18(4,5)6)12-17(20)16(3)11-15(2)13-19/h11-13,16-17,20H,9-10H2,1-8H3/b14-12+,15-11-/t16-,17+/m0/s1 |
| InChIKey | JXEKSIDLCISFLS-AXUPJHAVSA-N |
| XLogP | 4.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|