C26H51IO2Si2 — CID 135036510
tert-butyl-[(3E,5R,6R,7Z,9Z)-5-[tert-butyl(dimethyl)silyl]oxy-10-iodo-3,6,8-trimethylundeca-3,7,9-trienoxy]-dimethylsilane (PubChem CID 135036510) has the molecular formula C26H51IO2Si2 and a molecular weight of 578.77 g/mol. Its IUPAC name is tert-butyl-[(3E,5R,6R,7Z,9Z)-5-[tert-butyl(dimethyl)silyl]oxy-10-iodo-3,6,8-trimethylundeca-3,7,9-trienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3E,5R,6R,7Z,9Z)-5-[tert-butyl(dimethyl)silyl]oxy-10-iodo-3,6,8-trimethylundeca-3,7,9-trienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 135036510 |
| Molecular Formula | C26H51IO2Si2 |
| Molecular Weight | 578.77 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | tert-butyl-[(3E,5R,6R,7Z,9Z)-5-[tert-butyl(dimethyl)silyl]oxy-10-iodo-3,6,8-trimethylundeca-3,7,9-trienoxy]-dimethylsilane |
| SMILES | C/C(I)=C/C(C)=C\[C@@H](C)[C@H](/C=C(\C)CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H51IO2Si2/c1-20(15-16-28-30(11,12)25(5,6)7)19-24(29-31(13,14)26(8,9)10)22(3)17-21(2)18-23(4)27/h17-19,22,24H,15-16H2,1-14H3/b20-19+,21-17-,23-18-/t22-,24+/m1/s1 |
| InChIKey | DUDDBJPJYHVUNC-BUICGJFYSA-N |
| XLogP | 9.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.77 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|