C23H47IO2Si2 — CID 102077004
tert-butyl-[(2Z,4S,5S,6Z,8R)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-4,8-dimethylnona-2,6-dienoxy]-dimethylsilane (PubChem CID 102077004) has the molecular formula C23H47IO2Si2 and a molecular weight of 538.70 g/mol. Its IUPAC name is tert-butyl-[(2Z,4S,5S,6Z,8R)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-4,8-dimethylnona-2,6-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2Z,4S,5S,6Z,8R)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-4,8-dimethylnona-2,6-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 102077004 |
| Molecular Formula | C23H47IO2Si2 |
| Molecular Weight | 538.70 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | tert-butyl-[(2Z,4S,5S,6Z,8R)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-4,8-dimethylnona-2,6-dienoxy]-dimethylsilane |
| SMILES | C[C@H](/C=C\[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C\CO[Si](C)(C)C(C)(C)C)CI |
| InChI | InChI=1S/C23H47IO2Si2/c1-19(18-24)15-16-21(26-28(11,12)23(6,7)8)20(2)14-13-17-25-27(9,10)22(3,4)5/h13-16,19-21H,17-18H2,1-12H3/b14-13-,16-15-/t19-,20+,21+/m1/s1 |
| InChIKey | KWELAPDYJYRTSH-ATYAFAICSA-N |
| XLogP | 8.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.70 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|