C12H27O5PSi — CID 25137337
(E)-4-[tert-butyl(dimethyl)silyl]oxy-1-dimethoxyphosphorylbut-2-en-1-ol (PubChem CID 25137337) has the molecular formula C12H27O5PSi and a molecular weight of 310.40 g/mol. Its IUPAC name is (E)-4-[tert-butyl(dimethyl)silyl]oxy-1-dimethoxyphosphorylbut-2-en-1-ol.
| Compound Name | (E)-4-[tert-butyl(dimethyl)silyl]oxy-1-dimethoxyphosphorylbut-2-en-1-ol |
|---|---|
| PubChem CID | 25137337 |
| Molecular Formula | C12H27O5PSi |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (E)-4-[tert-butyl(dimethyl)silyl]oxy-1-dimethoxyphosphorylbut-2-en-1-ol |
| SMILES | COP(=O)(OC)C(O)/C=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H27O5PSi/c1-12(2,3)19(6,7)17-10-8-9-11(13)18(14,15-4)16-5/h8-9,11,13H,10H2,1-7H3/b9-8+ |
| InChIKey | YFEKVYQOKLUTKF-CMDGGOBGSA-N |
| XLogP | 3.37 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|