C18H34O3Si — CID 11141986
[(Z)-6-[tert-butyl(dimethyl)silyl]oxyhex-4-en-3-yl] (E)-hex-3-enoate (PubChem CID 11141986) has the molecular formula C18H34O3Si and a molecular weight of 326.55 g/mol. Its IUPAC name is [(Z)-6-[tert-butyl(dimethyl)silyl]oxyhex-4-en-3-yl] (E)-hex-3-enoate.
| Compound Name | [(Z)-6-[tert-butyl(dimethyl)silyl]oxyhex-4-en-3-yl] (E)-hex-3-enoate |
|---|---|
| PubChem CID | 11141986 |
| Molecular Formula | C18H34O3Si |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | [(Z)-6-[tert-butyl(dimethyl)silyl]oxyhex-4-en-3-yl] (E)-hex-3-enoate |
| SMILES | CC/C=C/CC(=O)OC(/C=C\CO[Si](C)(C)C(C)(C)C)CC |
| InChI | InChI=1S/C18H34O3Si/c1-8-10-11-14-17(19)21-16(9-2)13-12-15-20-22(6,7)18(3,4)5/h10-13,16H,8-9,14-15H2,1-7H3/b11-10+,13-12- |
| InChIKey | GFUKZPPUAGOVPK-MRBUWEIXSA-N |
| XLogP | 5.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|