C13H25IOSi — CID 71530233
tert-butyl-[(E,4E)-4-(iodomethylidene)hex-2-enoxy]-dimethylsilane (PubChem CID 71530233) has the molecular formula C13H25IOSi and a molecular weight of 352.33 g/mol. Its IUPAC name is tert-butyl-[(E,4E)-4-(iodomethylidene)hex-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,4E)-4-(iodomethylidene)hex-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 71530233 |
| Molecular Formula | C13H25IOSi |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | tert-butyl-[(E,4E)-4-(iodomethylidene)hex-2-enoxy]-dimethylsilane |
| SMILES | CCC(/C=C/CO[Si](C)(C)C(C)(C)C)=C\I |
| InChI | InChI=1S/C13H25IOSi/c1-7-12(11-14)9-8-10-15-16(5,6)13(2,3)4/h8-9,11H,7,10H2,1-6H3/b9-8+,12-11+ |
| InChIKey | ALEOZUQBNBMVNM-MVKOLZDDSA-N |
| XLogP | 5.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|