C25H48O3Si — CID 11144354
tert-butyl (2E,4E,7R)-12-[tert-butyl(dimethyl)silyl]oxy-3,5,7-trimethyldodeca-2,4-dienoate (PubChem CID 11144354) has the molecular formula C25H48O3Si and a molecular weight of 424.74 g/mol. Its IUPAC name is tert-butyl (2E,4E,7R)-12-[tert-butyl(dimethyl)silyl]oxy-3,5,7-trimethyldodeca-2,4-dienoate.
| Compound Name | tert-butyl (2E,4E,7R)-12-[tert-butyl(dimethyl)silyl]oxy-3,5,7-trimethyldodeca-2,4-dienoate |
|---|---|
| PubChem CID | 11144354 |
| Molecular Formula | C25H48O3Si |
| Molecular Weight | 424.74 g/mol |
| Exact Mass | 424.34 |
| IUPAC Name | tert-butyl (2E,4E,7R)-12-[tert-butyl(dimethyl)silyl]oxy-3,5,7-trimethyldodeca-2,4-dienoate |
| SMILES | CC(=C\C(=O)OC(C)(C)C)/C=C(\C)C[C@H](C)CCCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H48O3Si/c1-20(15-13-12-14-16-27-29(10,11)25(7,8)9)17-21(2)18-22(3)19-23(26)28-24(4,5)6/h18-20H,12-17H2,1-11H3/b21-18+,22-19+/t20-/m1/s1 |
| InChIKey | BMXIUPVEYZMGQS-VQCKDSJHSA-N |
| XLogP | 7.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.74 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|