C19H34O3 — CID 54084564
ethyl 11-methoxy-3,5,7,11-tetramethyldodeca-2,4-dienoate (PubChem CID 54084564) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is ethyl 11-methoxy-3,5,7,11-tetramethyldodeca-2,4-dienoate.
| Compound Name | ethyl 11-methoxy-3,5,7,11-tetramethyldodeca-2,4-dienoate |
|---|---|
| PubChem CID | 54084564 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | ethyl 11-methoxy-3,5,7,11-tetramethyldodeca-2,4-dienoate |
| SMILES | CCOC(=O)C=C(C)C=C(C)CC(C)CCCC(C)(C)OC |
| InChI | InChI=1S/C19H34O3/c1-8-22-18(20)14-17(4)13-16(3)12-15(2)10-9-11-19(5,6)21-7/h13-15H,8-12H2,1-7H3 |
| InChIKey | MPMYURRULHQZPJ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|