C23H34O3 — CID 88845415
benzyl (2E,4E)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate (PubChem CID 88845415) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is benzyl (2E,4E)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate.
| Compound Name | benzyl (2E,4E)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate |
|---|---|
| PubChem CID | 88845415 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | benzyl (2E,4E)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate |
| SMILES | COC(C)(C)CCCC(C)C/C=C/C(C)=C/C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H34O3/c1-19(13-10-16-23(3,4)25-5)11-9-12-20(2)17-22(24)26-18-21-14-7-6-8-15-21/h6-9,12,14-15,17,19H,10-11,13,16,18H2,1-5H3/b12-9+,20-17+ |
| InChIKey | BJJAWYJUVINTDI-ORNQDVSDSA-N |
| XLogP | 5.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|