C17H28Br2O2 — CID 161085246
ethyl (4E)-10,11-dibromo-3,7,11-trimethyldodeca-2,4-dienoate (PubChem CID 161085246) has the molecular formula C17H28Br2O2 and a molecular weight of 424.22 g/mol. Its IUPAC name is ethyl (4E)-10,11-dibromo-3,7,11-trimethyldodeca-2,4-dienoate.
| Compound Name | ethyl (4E)-10,11-dibromo-3,7,11-trimethyldodeca-2,4-dienoate |
|---|---|
| PubChem CID | 161085246 |
| Molecular Formula | C17H28Br2O2 |
| Molecular Weight | 424.22 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | ethyl (4E)-10,11-dibromo-3,7,11-trimethyldodeca-2,4-dienoate |
| SMILES | CCOC(=O)C=C(C)/C=C/CC(C)CCC(Br)C(C)(C)Br |
| InChI | InChI=1S/C17H28Br2O2/c1-6-21-16(20)12-14(3)9-7-8-13(2)10-11-15(18)17(4,5)19/h7,9,12-13,15H,6,8,10-11H2,1-5H3/b9-7+,14-12? |
| InChIKey | UGKOGBBDBBHJPT-OZXMPOONSA-N |
| XLogP | 5.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.22 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|