C19H30O2 — CID 88828551
prop-2-enyl (2E,4E,10E)-3,7,11-trimethyltrideca-2,4,10-trienoate (PubChem CID 88828551) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is prop-2-enyl (2E,4E,10E)-3,7,11-trimethyltrideca-2,4,10-trienoate.
| Compound Name | prop-2-enyl (2E,4E,10E)-3,7,11-trimethyltrideca-2,4,10-trienoate |
|---|---|
| PubChem CID | 88828551 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | prop-2-enyl (2E,4E,10E)-3,7,11-trimethyltrideca-2,4,10-trienoate |
| SMILES | C=CCOC(=O)/C=C(C)/C=C/CC(C)CC/C=C(\C)CC |
| InChI | InChI=1S/C19H30O2/c1-6-14-21-19(20)15-18(5)13-9-12-17(4)11-8-10-16(3)7-2/h6,9-10,13,15,17H,1,7-8,11-12,14H2,2-5H3/b13-9+,16-10+,18-15+ |
| InChIKey | HPZXMZQAWJYVKE-VUSOQKHXSA-N |
| XLogP | 5.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|