C22H40O4 — CID 129230306
(2-hydroxy-4-methylpentyl) (2E,4E,7S)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate (PubChem CID 129230306) has the molecular formula C22H40O4 and a molecular weight of 368.56 g/mol. Its IUPAC name is (2-hydroxy-4-methylpentyl) (2E,4E,7S)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate.
| Compound Name | (2-hydroxy-4-methylpentyl) (2E,4E,7S)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate |
|---|---|
| PubChem CID | 129230306 |
| Molecular Formula | C22H40O4 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | (2-hydroxy-4-methylpentyl) (2E,4E,7S)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate |
| SMILES | COC(C)(C)CCC[C@H](C)C/C=C/C(C)=C/C(=O)OCC(O)CC(C)C |
| InChI | InChI=1S/C22H40O4/c1-17(2)14-20(23)16-26-21(24)15-19(4)11-8-10-18(3)12-9-13-22(5,6)25-7/h8,11,15,17-18,20,23H,9-10,12-14,16H2,1-7H3/b11-8+,19-15+/t18-,20?/m1/s1 |
| InChIKey | AAUABBYANPUJBE-GMKOKECMSA-N |
| XLogP | 5.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|