C16H27O3- — CID 22235072
(2E,4E)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate (PubChem CID 22235072) has the molecular formula C16H27O3- and a molecular weight of 267.39 g/mol. Its IUPAC name is (2E,4E)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate.
| Compound Name | (2E,4E)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate |
|---|---|
| PubChem CID | 22235072 |
| Molecular Formula | C16H27O3- |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | (2E,4E)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate |
| SMILES | COC(C)(C)CCCC(C)C/C=C/C(C)=C/C(=O)[O-] |
| InChI | InChI=1S/C16H28O3/c1-13(10-7-11-16(3,4)19-5)8-6-9-14(2)12-15(17)18/h6,9,12-13H,7-8,10-11H2,1-5H3,(H,17,18)/p-1/b9-6+,14-12+ |
| InChIKey | MNYBEULOKRVZKY-TZOAMJEDSA-M |
| XLogP | 2.86 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|