C36H53NO7 — CID 137379951
ethyl N-[2-(4-phenoxyphenoxy)ethyl]carbamate;propan-2-yl (2E,4E)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate (PubChem CID 137379951) has the molecular formula C36H53NO7 and a molecular weight of 611.82 g/mol. Its IUPAC name is ethyl N-[2-(4-phenoxyphenoxy)ethyl]carbamate;propan-2-yl (2E,4E)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate.
| Compound Name | ethyl N-[2-(4-phenoxyphenoxy)ethyl]carbamate;propan-2-yl (2E,4E)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate |
|---|---|
| PubChem CID | 137379951 |
| Molecular Formula | C36H53NO7 |
| Molecular Weight | 611.82 g/mol |
| Exact Mass | 611.38 |
| IUPAC Name | ethyl N-[2-(4-phenoxyphenoxy)ethyl]carbamate;propan-2-yl (2E,4E)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate |
| SMILES | CCOC(=O)NCCOc1ccc(Oc2ccccc2)cc1.COC(C)(C)CCCC(C)C/C=C/C(C)=C/C(=O)OC(C)C |
| InChI | InChI=1S/C19H34O3.C17H19NO4/c1-15(2)22-18(20)14-17(4)11-8-10-16(3)12-9-13-19(5,6)21-7;1-2-20-17(19)18-12-13-21-14-8-10-16(11-9-14)22-15-6-4-3-5-7-15/h8,11,14-16H,9-10,12-13H2,1-7H3;3-11H,2,12-13H2,1H3,(H,18,19)/b11-8+,17-14+; |
| InChIKey | SRXQAAXCSAYGJZ-REMOVKLSSA-N |
| XLogP | 8.67 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.82 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|