C19H31NO4 — CID 22158871
ethyl N-[2-[4-(5-methylheptan-3-yloxy)phenoxy]ethyl]carbamate (PubChem CID 22158871) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is ethyl N-[2-[4-(5-methylheptan-3-yloxy)phenoxy]ethyl]carbamate.
| Compound Name | ethyl N-[2-[4-(5-methylheptan-3-yloxy)phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 22158871 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | ethyl N-[2-[4-(5-methylheptan-3-yloxy)phenoxy]ethyl]carbamate |
| SMILES | CCOC(=O)NCCOc1ccc(OC(CC)CC(C)CC)cc1 |
| InChI | InChI=1S/C19H31NO4/c1-5-15(4)14-16(6-2)24-18-10-8-17(9-11-18)23-13-12-20-19(21)22-7-3/h8-11,15-16H,5-7,12-14H2,1-4H3,(H,20,21) |
| InChIKey | NHDWAMRXRBAJJQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|