C29H48O3 — CID 160907499
1-methyl-4-propan-2-ylbenzene;propan-2-yl 11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate (PubChem CID 160907499) has the molecular formula C29H48O3 and a molecular weight of 444.70 g/mol. Its IUPAC name is 1-methyl-4-propan-2-ylbenzene;propan-2-yl 11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate.
| Compound Name | 1-methyl-4-propan-2-ylbenzene;propan-2-yl 11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate |
|---|---|
| PubChem CID | 160907499 |
| Molecular Formula | C29H48O3 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | 1-methyl-4-propan-2-ylbenzene;propan-2-yl 11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate |
| SMILES | COC(C)(C)CCCC(C)CC=CC(C)=CC(=O)OC(C)C.Cc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C19H34O3.C10H14/c1-15(2)22-18(20)14-17(4)11-8-10-16(3)12-9-13-19(5,6)21-7;1-8(2)10-6-4-9(3)5-7-10/h8,11,14-16H,9-10,12-13H2,1-7H3;4-8H,1-3H3 |
| InChIKey | SQILGRPYXSCWBH-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|