C37H64O6 — CID 91068703
methyl (2E,6E)-10-(3,3-dimethyloxiran-2-yl)-7-ethyl-3-methyldeca-2,6-dienoate;propan-2-yl (2E,4E)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate (PubChem CID 91068703) has the molecular formula C37H64O6 and a molecular weight of 604.91 g/mol. Its IUPAC name is methyl (2E,6E)-10-(3,3-dimethyloxiran-2-yl)-7-ethyl-3-methyldeca-2,6-dienoate;propan-2-yl (2E,4E)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate.
| Compound Name | methyl (2E,6E)-10-(3,3-dimethyloxiran-2-yl)-7-ethyl-3-methyldeca-2,6-dienoate;propan-2-yl (2E,4E)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate |
|---|---|
| PubChem CID | 91068703 |
| Molecular Formula | C37H64O6 |
| Molecular Weight | 604.91 g/mol |
| Exact Mass | 604.47 |
| IUPAC Name | methyl (2E,6E)-10-(3,3-dimethyloxiran-2-yl)-7-ethyl-3-methyldeca-2,6-dienoate;propan-2-yl (2E,4E)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate |
| SMILES | CC/C(=C\CC/C(C)=C/C(=O)OC)CCCC1OC1(C)C.COC(C)(C)CCCC(C)C/C=C/C(C)=C/C(=O)OC(C)C |
| InChI | InChI=1S/C19H34O3.C18H30O3/c1-15(2)22-18(20)14-17(4)11-8-10-16(3)12-9-13-19(5,6)21-7;1-6-15(11-8-12-16-18(3,4)21-16)10-7-9-14(2)13-17(19)20-5/h8,11,14-16H,9-10,12-13H2,1-7H3;10,13,16H,6-9,11-12H2,1-5H3/b11-8+,17-14+;14-13+,15-10+ |
| InChIKey | NZLSHXKIYLRFNO-GWJDOWNDSA-N |
| XLogP | 9.63 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.91 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|