C18H30O2 — CID 86733732
propan-2-yl (4E)-3,7,11-trimethyldodeca-2,4,10-trienoate (PubChem CID 86733732) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is propan-2-yl (4E)-3,7,11-trimethyldodeca-2,4,10-trienoate.
| Compound Name | propan-2-yl (4E)-3,7,11-trimethyldodeca-2,4,10-trienoate |
|---|---|
| PubChem CID | 86733732 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | propan-2-yl (4E)-3,7,11-trimethyldodeca-2,4,10-trienoate |
| SMILES | CC(C)=CCCC(C)C/C=C/C(C)=CC(=O)OC(C)C |
| InChI | InChI=1S/C18H30O2/c1-14(2)9-7-10-16(5)11-8-12-17(6)13-18(19)20-15(3)4/h8-9,12-13,15-16H,7,10-11H2,1-6H3/b12-8+,17-13? |
| InChIKey | PXQZZXXYQJDJPE-NLFVLIHZSA-N |
| XLogP | 5.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|