C17H30O2 — CID 21437627
methyl (2E,4E)-3,7,10,11-tetramethyldodeca-2,4-dienoate (PubChem CID 21437627) has the molecular formula C17H30O2 and a molecular weight of 266.43 g/mol. Its IUPAC name is methyl (2E,4E)-3,7,10,11-tetramethyldodeca-2,4-dienoate.
| Compound Name | methyl (2E,4E)-3,7,10,11-tetramethyldodeca-2,4-dienoate |
|---|---|
| PubChem CID | 21437627 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | methyl (2E,4E)-3,7,10,11-tetramethyldodeca-2,4-dienoate |
| SMILES | COC(=O)/C=C(C)/C=C/CC(C)CCC(C)C(C)C |
| InChI | InChI=1S/C17H30O2/c1-13(2)16(5)11-10-14(3)8-7-9-15(4)12-17(18)19-6/h7,9,12-14,16H,8,10-11H2,1-6H3/b9-7+,15-12+ |
| InChIKey | DENIZNDGKQCAAG-KDFHGORWSA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|