C15H25KO2 — CID 23666617
potassium (2E,4E)-3,7,11-trimethyldodeca-2,4-dienoate (PubChem CID 23666617) has the molecular formula C15H25KO2 and a molecular weight of 276.46 g/mol. Its IUPAC name is potassium (2E,4E)-3,7,11-trimethyldodeca-2,4-dienoate.
| Compound Name | potassium (2E,4E)-3,7,11-trimethyldodeca-2,4-dienoate |
|---|---|
| PubChem CID | 23666617 |
| Molecular Formula | C15H25KO2 |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | potassium (2E,4E)-3,7,11-trimethyldodeca-2,4-dienoate |
| SMILES | CC(/C=C/CC(C)CCCC(C)C)=C\C(=O)[O-].[K+] |
| InChI | InChI=1S/C15H26O2.K/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15(16)17;/h6,10-13H,5,7-9H2,1-4H3,(H,16,17);/q;+1/p-1/b10-6+,14-11+; |
| InChIKey | QUIBYNPPTJZHPB-DLYKSEDFSA-M |
| XLogP | 0.10 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|