C16H27ClO — CID 21437686
(2E,4E)-3,7,11-trimethyltrideca-2,4-dienoyl chloride (PubChem CID 21437686) has the molecular formula C16H27ClO and a molecular weight of 270.84 g/mol. Its IUPAC name is (2E,4E)-3,7,11-trimethyltrideca-2,4-dienoyl chloride.
| Compound Name | (2E,4E)-3,7,11-trimethyltrideca-2,4-dienoyl chloride |
|---|---|
| PubChem CID | 21437686 |
| Molecular Formula | C16H27ClO |
| Molecular Weight | 270.84 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (2E,4E)-3,7,11-trimethyltrideca-2,4-dienoyl chloride |
| SMILES | CCC(C)CCCC(C)C/C=C/C(C)=C/C(=O)Cl |
| InChI | InChI=1S/C16H27ClO/c1-5-13(2)8-6-9-14(3)10-7-11-15(4)12-16(17)18/h7,11-14H,5-6,8-10H2,1-4H3/b11-7+,15-12+ |
| InChIKey | SPRKPEDODPQZQI-XLMIDGIWSA-N |
| XLogP | 5.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.84 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|