7-ethyl-3,11-dimethyltrideca-2,4-dienoic acid

C17H30O2 — CID 54310202

IUPAC7-ethyl-3,11-dimethyltrideca-2,4-dienoic acid
SMILESCCC(C)CCCC(CC)CC=CC(C)=CC(=O)O
InChIInChI=1S/C17H30O2/c1-5-14(3)9-7-11-16(6-2)12-8-10-15(4)13-17(18)19/h8,10,13-14,16H,5-7,9,11-12H2,1-4H3,(H,18,19)
InChIKeySKINRSXQEVPZPX-UHFFFAOYSA-N
MW266.43 g/mol
LogP5.21
Rot. Bonds10

About 7-ethyl-3,11-dimethyltrideca-2,4-dienoic acid

7-ethyl-3,11-dimethyltrideca-2,4-dienoic acid (PubChem CID 54310202) has the molecular formula C17H30O2 and a molecular weight of 266.43 g/mol. Its IUPAC name is 7-ethyl-3,11-dimethyltrideca-2,4-dienoic acid.

Molecular Properties

Compound Name7-ethyl-3,11-dimethyltrideca-2,4-dienoic acid
PubChem CID54310202
Molecular FormulaC17H30O2
Molecular Weight266.43 g/mol
Exact Mass266.22
IUPAC Name7-ethyl-3,11-dimethyltrideca-2,4-dienoic acid
SMILESCCC(C)CCCC(CC)CC=CC(C)=CC(=O)O
InChIInChI=1S/C17H30O2/c1-5-14(3)9-7-11-16(6-2)12-8-10-15(4)13-17(18)19/h8,10,13-14,16H,5-7,9,11-12H2,1-4H3,(H,18,19)
InChIKeySKINRSXQEVPZPX-UHFFFAOYSA-N
XLogP5.21
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds10
Heavy Atoms19
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500266.43
LogP ≤ 55.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 7-ethyl-3,11-dimethyltrideca-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-ethyl-3,11-dimethyltrideca-2,4-dienoic acid?
The IUPAC name of 7-ethyl-3,11-dimethyltrideca-2,4-dienoic acid (CID 54310202) is 7-ethyl-3,11-dimethyltrideca-2,4-dienoic acid.
What is the SMILES notation for 7-ethyl-3,11-dimethyltrideca-2,4-dienoic acid?
The canonical SMILES for 7-ethyl-3,11-dimethyltrideca-2,4-dienoic acid is CCC(C)CCCC(CC)CC=CC(C)=CC(=O)O.
What is the InChIKey of 7-ethyl-3,11-dimethyltrideca-2,4-dienoic acid?
The InChIKey is SKINRSXQEVPZPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O2/c1-5-14(3)9-7-11-16(6-2)12-8-10-15(4)13-17(18)19/h8,10,13-14,16H,5-7,9,11-12H2,1-4H3,(H,18,19).
What are the key properties of 7-ethyl-3,11-dimethyltrideca-2,4-dienoic acid?
7-ethyl-3,11-dimethyltrideca-2,4-dienoic acid has a molecular weight of 266.43 g/mol, XLogP of 5.21, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-3,11-dimethyltrideca-2,4-dienoic acid is sourced from PubChem (CID 54310202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).