C17H30O2 — CID 54310202
7-ethyl-3,11-dimethyltrideca-2,4-dienoic acid (PubChem CID 54310202) has the molecular formula C17H30O2 and a molecular weight of 266.43 g/mol. Its IUPAC name is 7-ethyl-3,11-dimethyltrideca-2,4-dienoic acid.
| Compound Name | 7-ethyl-3,11-dimethyltrideca-2,4-dienoic acid |
|---|---|
| PubChem CID | 54310202 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 7-ethyl-3,11-dimethyltrideca-2,4-dienoic acid |
| SMILES | CCC(C)CCCC(CC)CC=CC(C)=CC(=O)O |
| InChI | InChI=1S/C17H30O2/c1-5-14(3)9-7-11-16(6-2)12-8-10-15(4)13-17(18)19/h8,10,13-14,16H,5-7,9,11-12H2,1-4H3,(H,18,19) |
| InChIKey | SKINRSXQEVPZPX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|