C19H32O — CID 54128642
9-ethyl-5,13-dimethylpentadeca-4,6,12-trien-3-one (PubChem CID 54128642) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is 9-ethyl-5,13-dimethylpentadeca-4,6,12-trien-3-one.
| Compound Name | 9-ethyl-5,13-dimethylpentadeca-4,6,12-trien-3-one |
|---|---|
| PubChem CID | 54128642 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | 9-ethyl-5,13-dimethylpentadeca-4,6,12-trien-3-one |
| SMILES | CCC(=O)C=C(C)C=CCC(CC)CCC=C(C)CC |
| InChI | InChI=1S/C19H32O/c1-6-16(4)11-9-13-18(7-2)14-10-12-17(5)15-19(20)8-3/h10-12,15,18H,6-9,13-14H2,1-5H3 |
| InChIKey | NSSUCIVXXNHLJG-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|