About (3-ethyl-7-methylnon-6-enyl) 2-oxopentanoate
(3-ethyl-7-methylnon-6-enyl) 2-oxopentanoate (PubChem CID 156896263) has the molecular formula C17H30O3
and a molecular weight of 282.42 g/mol. Its IUPAC name is (3-ethyl-7-methylnon-6-enyl) 2-oxopentanoate.
Molecular Properties
| Compound Name | (3-ethyl-7-methylnon-6-enyl) 2-oxopentanoate |
| PubChem CID | 156896263 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | (3-ethyl-7-methylnon-6-enyl) 2-oxopentanoate |
| SMILES | CCCC(=O)C(=O)OCCC(CC)CCC=C(C)CC |
| InChI | InChI=1S/C17H30O3/c1-5-9-16(18)17(19)20-13-12-15(7-3)11-8-10-14(4)6-2/h10,15H,5-9,11-13H2,1-4H3 |
| InChIKey | OIKRGXIAGWQGOJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3-ethyl-7-methylnon-6-enyl) 2-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethyl-7-methylnon-6-enyl) 2-oxopentanoate?
The IUPAC name of (3-ethyl-7-methylnon-6-enyl) 2-oxopentanoate (CID 156896263) is (3-ethyl-7-methylnon-6-enyl) 2-oxopentanoate.
What is the SMILES notation for (3-ethyl-7-methylnon-6-enyl) 2-oxopentanoate?
The canonical SMILES for (3-ethyl-7-methylnon-6-enyl) 2-oxopentanoate is CCCC(=O)C(=O)OCCC(CC)CCC=C(C)CC.
What is the InChIKey of (3-ethyl-7-methylnon-6-enyl) 2-oxopentanoate?
The InChIKey is OIKRGXIAGWQGOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O3/c1-5-9-16(18)17(19)20-13-12-15(7-3)11-8-10-14(4)6-2/h10,15H,5-9,11-13H2,1-4H3.
What are the key properties of (3-ethyl-7-methylnon-6-enyl) 2-oxopentanoate?
(3-ethyl-7-methylnon-6-enyl) 2-oxopentanoate has a molecular weight of 282.42 g/mol, XLogP of 4.45, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-7-methylnon-6-enyl) 2-oxopentanoate is sourced from PubChem (CID 156896263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).