C15H28 — CID 154162767
6-ethyl-10-methyldodeca-1,3-diene (PubChem CID 154162767) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is 6-ethyl-10-methyldodeca-1,3-diene.
| Compound Name | 6-ethyl-10-methyldodeca-1,3-diene |
|---|---|
| PubChem CID | 154162767 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | 6-ethyl-10-methyldodeca-1,3-diene |
| SMILES | C=CC=CCC(CC)CCCC(C)CC |
| InChI | InChI=1S/C15H28/c1-5-8-9-12-15(7-3)13-10-11-14(4)6-2/h5,8-9,14-15H,1,6-7,10-13H2,2-4H3 |
| InChIKey | NQHWHNDAHACQQY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|