C26H52 — CID 91267212
5-ethyl-9,16,19,19-tetramethylicos-2-ene (PubChem CID 91267212) has the molecular formula C26H52 and a molecular weight of 364.70 g/mol. Its IUPAC name is 5-ethyl-9,16,19,19-tetramethylicos-2-ene.
| Compound Name | 5-ethyl-9,16,19,19-tetramethylicos-2-ene |
|---|---|
| PubChem CID | 91267212 |
| Molecular Formula | C26H52 |
| Molecular Weight | 364.70 g/mol |
| Exact Mass | 364.41 |
| IUPAC Name | 5-ethyl-9,16,19,19-tetramethylicos-2-ene |
| SMILES | CC=CCC(CC)CCCC(C)CCCCCCC(C)CCC(C)(C)C |
| InChI | InChI=1S/C26H52/c1-8-10-19-25(9-2)20-15-18-23(3)16-13-11-12-14-17-24(4)21-22-26(5,6)7/h8,10,23-25H,9,11-22H2,1-7H3 |
| InChIKey | OKBWJCLCMLMIJM-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.70 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|