C20H44 — CID 159071940
methane;2,2,5,9,13-pentamethyltetradecane (PubChem CID 159071940) has the molecular formula C20H44 and a molecular weight of 284.57 g/mol. Its IUPAC name is methane;2,2,5,9,13-pentamethyltetradecane.
| Compound Name | methane;2,2,5,9,13-pentamethyltetradecane |
|---|---|
| PubChem CID | 159071940 |
| Molecular Formula | C20H44 |
| Molecular Weight | 284.57 g/mol |
| Exact Mass | 284.34 |
| IUPAC Name | methane;2,2,5,9,13-pentamethyltetradecane |
| SMILES | C.CC(C)CCCC(C)CCCC(C)CCC(C)(C)C |
| InChI | InChI=1S/C19H40.CH4/c1-16(2)10-8-11-17(3)12-9-13-18(4)14-15-19(5,6)7;/h16-18H,8-15H2,1-7H3;1H4 |
| InChIKey | JZTMVOPFMKXIOI-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.57 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |