C14H32 — CID 160668864
methane;2,2,6-trimethyl-5-propan-2-ylheptane (PubChem CID 160668864) has the molecular formula C14H32 and a molecular weight of 200.41 g/mol. Its IUPAC name is methane;2,2,6-trimethyl-5-propan-2-ylheptane.
| Compound Name | methane;2,2,6-trimethyl-5-propan-2-ylheptane |
|---|---|
| PubChem CID | 160668864 |
| Molecular Formula | C14H32 |
| Molecular Weight | 200.41 g/mol |
| Exact Mass | 200.25 |
| IUPAC Name | methane;2,2,6-trimethyl-5-propan-2-ylheptane |
| SMILES | C.CC(C)C(CCC(C)(C)C)C(C)C |
| InChI | InChI=1S/C13H28.CH4/c1-10(2)12(11(3)4)8-9-13(5,6)7;/h10-12H,8-9H2,1-7H3;1H4 |
| InChIKey | RMQYUSASKYQOKW-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.41 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |