C14H31N — CID 156542499
N-(2,2-dimethylpropyl)-N,5,5-trimethylhexan-2-amine (PubChem CID 156542499) has the molecular formula C14H31N and a molecular weight of 213.41 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-N,5,5-trimethylhexan-2-amine.
| Compound Name | N-(2,2-dimethylpropyl)-N,5,5-trimethylhexan-2-amine |
|---|---|
| PubChem CID | 156542499 |
| Molecular Formula | C14H31N |
| Molecular Weight | 213.41 g/mol |
| Exact Mass | 213.25 |
| IUPAC Name | N-(2,2-dimethylpropyl)-N,5,5-trimethylhexan-2-amine |
| SMILES | CC(CCC(C)(C)C)N(C)CC(C)(C)C |
| InChI | InChI=1S/C14H31N/c1-12(9-10-13(2,3)4)15(8)11-14(5,6)7/h12H,9-11H2,1-8H3 |
| InChIKey | UZIKGMMBDKYPMT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |