C13H30N2 — CID 159238333
N,N'-bis(2,2-dimethylpropyl)-N,N'-dimethylmethanediamine (PubChem CID 159238333) has the molecular formula C13H30N2 and a molecular weight of 214.40 g/mol. Its IUPAC name is N,N'-bis(2,2-dimethylpropyl)-N,N'-dimethylmethanediamine.
| Compound Name | N,N'-bis(2,2-dimethylpropyl)-N,N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 159238333 |
| Molecular Formula | C13H30N2 |
| Molecular Weight | 214.40 g/mol |
| Exact Mass | 214.24 |
| IUPAC Name | N,N'-bis(2,2-dimethylpropyl)-N,N'-dimethylmethanediamine |
| SMILES | CN(CN(C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C13H30N2/c1-12(2,3)9-14(7)11-15(8)10-13(4,5)6/h9-11H2,1-8H3 |
| InChIKey | LIXIIMOKCHWWOW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|