C10H22N2O2 — CID 63053244
2-amino-4-[2,2-dimethylpropyl(methyl)amino]butanoic acid (PubChem CID 63053244) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-amino-4-[2,2-dimethylpropyl(methyl)amino]butanoic acid.
| Compound Name | 2-amino-4-[2,2-dimethylpropyl(methyl)amino]butanoic acid |
|---|---|
| PubChem CID | 63053244 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 2-amino-4-[2,2-dimethylpropyl(methyl)amino]butanoic acid |
| SMILES | CN(CCC(N)C(=O)O)CC(C)(C)C |
| InChI | InChI=1S/C10H22N2O2/c1-10(2,3)7-12(4)6-5-8(11)9(13)14/h8H,5-7,11H2,1-4H3,(H,13,14) |
| InChIKey | MUCZWBHLYYUHBX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |