C9H20N2O5 — CID 23619747
(2S)-2-aminopentanedioic acid;2-(dimethylamino)ethanol (PubChem CID 23619747) has the molecular formula C9H20N2O5 and a molecular weight of 236.27 g/mol. Its IUPAC name is (2S)-2-aminopentanedioic acid;2-(dimethylamino)ethanol.
| Compound Name | (2S)-2-aminopentanedioic acid;2-(dimethylamino)ethanol |
|---|---|
| PubChem CID | 23619747 |
| Molecular Formula | C9H20N2O5 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (2S)-2-aminopentanedioic acid;2-(dimethylamino)ethanol |
| SMILES | CN(C)CCO.N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO4.C4H11NO/c6-3(5(9)10)1-2-4(7)8;1-5(2)3-4-6/h3H,1-2,6H2,(H,7,8)(H,9,10);6H,3-4H2,1-2H3/t3-;/m0./s1 |
| InChIKey | IKFZABILOXSNSM-DFWYDOINSA-N |
| XLogP | -1.20 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |