About lithium;hydride;N,N,2,2-tetramethylpropan-1-amine
lithium;hydride;N,N,2,2-tetramethylpropan-1-amine (PubChem CID 174663551) has the molecular formula C7H18LiN
and a molecular weight of 123.17 g/mol. Its IUPAC name is lithium;hydride;N,N,2,2-tetramethylpropan-1-amine.
Molecular Properties
| Compound Name | lithium;hydride;N,N,2,2-tetramethylpropan-1-amine |
| PubChem CID | 174663551 |
| Molecular Formula | C7H18LiN |
| Molecular Weight | 123.17 g/mol |
| Exact Mass | 123.16 |
| IUPAC Name | lithium;hydride;N,N,2,2-tetramethylpropan-1-amine |
| SMILES | CN(C)CC(C)(C)C.[H-].[Li+] |
| InChI | InChI=1S/C7H17N.Li.H/c1-7(2,3)6-8(4)5;;/h6H2,1-5H3;;/q;+1;-1 |
| InChIKey | BUHXPKAVNLZWLQ-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.17 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze lithium;hydride;N,N,2,2-tetramethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;N,N,2,2-tetramethylpropan-1-amine?
The IUPAC name of lithium;hydride;N,N,2,2-tetramethylpropan-1-amine (CID 174663551) is lithium;hydride;N,N,2,2-tetramethylpropan-1-amine.
What is the SMILES notation for lithium;hydride;N,N,2,2-tetramethylpropan-1-amine?
The canonical SMILES for lithium;hydride;N,N,2,2-tetramethylpropan-1-amine is CN(C)CC(C)(C)C.[H-].[Li+].
What is the InChIKey of lithium;hydride;N,N,2,2-tetramethylpropan-1-amine?
The InChIKey is BUHXPKAVNLZWLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N.Li.H/c1-7(2,3)6-8(4)5;;/h6H2,1-5H3;;/q;+1;-1.
What are the key properties of lithium;hydride;N,N,2,2-tetramethylpropan-1-amine?
lithium;hydride;N,N,2,2-tetramethylpropan-1-amine has a molecular weight of 123.17 g/mol, XLogP of -1.29, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;N,N,2,2-tetramethylpropan-1-amine is sourced from PubChem (CID 174663551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).