C14H32O — CID 158785130
1-methoxy-3,3-dimethylbutane;2,2,3-trimethylbutane (PubChem CID 158785130) has the molecular formula C14H32O and a molecular weight of 216.41 g/mol. Its IUPAC name is 1-methoxy-3,3-dimethylbutane;2,2,3-trimethylbutane.
| Compound Name | 1-methoxy-3,3-dimethylbutane;2,2,3-trimethylbutane |
|---|---|
| PubChem CID | 158785130 |
| Molecular Formula | C14H32O |
| Molecular Weight | 216.41 g/mol |
| Exact Mass | 216.25 |
| IUPAC Name | 1-methoxy-3,3-dimethylbutane;2,2,3-trimethylbutane |
| SMILES | CC(C)C(C)(C)C.COCCC(C)(C)C |
| InChI | InChI=1S/C7H16O.C7H16/c1-7(2,3)5-6-8-4;1-6(2)7(3,4)5/h5-6H2,1-4H3;6H,1-5H3 |
| InChIKey | IRORSXMRPBRZLO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |